C17H18ClF3N4O2S — CID 86700933
S-(3,3,3-trifluoropropyl) 4-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-4-oxobutanethioate (PubChem CID 86700933) has the molecular formula C17H18ClF3N4O2S and a molecular weight of 434.87 g/mol. Its IUPAC name is S-(3,3,3-trifluoropropyl) 4-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-4-oxobutanethioate.
| Compound Name | S-(3,3,3-trifluoropropyl) 4-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-4-oxobutanethioate |
|---|---|
| PubChem CID | 86700933 |
| Molecular Formula | C17H18ClF3N4O2S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | S-(3,3,3-trifluoropropyl) 4-[(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-ethylamino]-4-oxobutanethioate |
| SMILES | CCN(C(=O)CCC(=O)SCCC(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C17H18ClF3N4O2S/c1-2-24(14(26)5-6-15(27)28-9-7-17(19,20)21)13-11-25(23-16(13)18)12-4-3-8-22-10-12/h3-4,8,10-11H,2,5-7,9H2,1H3 |
| InChIKey | YAGWRJCMVGNUOC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|