C15H22N6O2 — CID 86700958
1-[(3S,3aR,6S,6aR)-3-azido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(cyclohexylmethyl)triazole (PubChem CID 86700958) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aR)-3-azido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(cyclohexylmethyl)triazole.
| Compound Name | 1-[(3S,3aR,6S,6aR)-3-azido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(cyclohexylmethyl)triazole |
|---|---|
| PubChem CID | 86700958 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 1-[(3S,3aR,6S,6aR)-3-azido-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]-4-(cyclohexylmethyl)triazole |
| SMILES | [N-]=[N+]=N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2n1cc(CC2CCCCC2)nn1 |
| InChI | InChI=1S/C15H22N6O2/c16-19-18-12-8-22-15-13(9-23-14(12)15)21-7-11(17-20-21)6-10-4-2-1-3-5-10/h7,10,12-15H,1-6,8-9H2/t12-,13-,14+,15+/m0/s1 |
| InChIKey | VCRPPXDZHZUNIX-BYNSBNAKSA-N |
| XLogP | 2.42 |
| TPSA | 97.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|