About 4-(2,2-difluoropentoxy)-2,5-dimethylaniline
4-(2,2-difluoropentoxy)-2,5-dimethylaniline (PubChem CID 86701343) has the molecular formula C13H19F2NO
and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-(2,2-difluoropentoxy)-2,5-dimethylaniline.
Molecular Properties
| Compound Name | 4-(2,2-difluoropentoxy)-2,5-dimethylaniline |
| PubChem CID | 86701343 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-(2,2-difluoropentoxy)-2,5-dimethylaniline |
| SMILES | CCCC(F)(F)COc1cc(C)c(N)cc1C |
| InChI | InChI=1S/C13H19F2NO/c1-4-5-13(14,15)8-17-12-7-9(2)11(16)6-10(12)3/h6-7H,4-5,8,16H2,1-3H3 |
| InChIKey | CKLPUCOQXUEAPS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoropentoxy)-2,5-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoropentoxy)-2,5-dimethylaniline?
The IUPAC name of 4-(2,2-difluoropentoxy)-2,5-dimethylaniline (CID 86701343) is 4-(2,2-difluoropentoxy)-2,5-dimethylaniline.
What is the SMILES notation for 4-(2,2-difluoropentoxy)-2,5-dimethylaniline?
The canonical SMILES for 4-(2,2-difluoropentoxy)-2,5-dimethylaniline is CCCC(F)(F)COc1cc(C)c(N)cc1C.
What is the InChIKey of 4-(2,2-difluoropentoxy)-2,5-dimethylaniline?
The InChIKey is CKLPUCOQXUEAPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2NO/c1-4-5-13(14,15)8-17-12-7-9(2)11(16)6-10(12)3/h6-7H,4-5,8,16H2,1-3H3.
What are the key properties of 4-(2,2-difluoropentoxy)-2,5-dimethylaniline?
4-(2,2-difluoropentoxy)-2,5-dimethylaniline has a molecular weight of 243.30 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoropentoxy)-2,5-dimethylaniline is sourced from PubChem (CID 86701343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).