About 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole
6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole (PubChem CID 86701560) has the molecular formula C18H15BrFN3
and a molecular weight of 372.24 g/mol. Its IUPAC name is 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole |
| PubChem CID | 86701560 |
| Molecular Formula | C18H15BrFN3 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole |
| SMILES | Cc1cc(C)c2[nH]ccc2c1Cc1nc2c(F)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C18H15BrFN3/c1-9-5-10(2)17-12(3-4-21-17)13(9)8-16-22-15-7-11(19)6-14(20)18(15)23-16/h3-7,21H,8H2,1-2H3,(H,22,23) |
| InChIKey | SNYXAWPWDYHNHQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole?
The IUPAC name of 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole (CID 86701560) is 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole.
What is the SMILES notation for 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole?
The canonical SMILES for 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole is Cc1cc(C)c2[nH]ccc2c1Cc1nc2c(F)cc(Br)cc2[nH]1.
What is the InChIKey of 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole?
The InChIKey is SNYXAWPWDYHNHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrFN3/c1-9-5-10(2)17-12(3-4-21-17)13(9)8-16-22-15-7-11(19)6-14(20)18(15)23-16/h3-7,21H,8H2,1-2H3,(H,22,23).
What are the key properties of 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole?
6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole has a molecular weight of 372.24 g/mol, XLogP of 5.15, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[(5,7-dimethyl-1H-indol-4-yl)methyl]-4-fluoro-1H-benzimidazole is sourced from PubChem (CID 86701560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).