About 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile
2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile (PubChem CID 86701604) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile |
| PubChem CID | 86701604 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile |
| SMILES | COC(C)(c1nc2ccc(C#N)cc2[nH]1)c1c(C)cc(C)c2[nH]ccc12 |
| InChI | InChI=1S/C21H20N4O/c1-12-9-13(2)19-15(7-8-23-19)18(12)21(3,26-4)20-24-16-6-5-14(11-22)10-17(16)25-20/h5-10,23H,1-4H3,(H,24,25) |
| InChIKey | NTXVYWVBRJBBAW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile?
The IUPAC name of 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile (CID 86701604) is 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile.
What is the SMILES notation for 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile?
The canonical SMILES for 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile is COC(C)(c1nc2ccc(C#N)cc2[nH]1)c1c(C)cc(C)c2[nH]ccc12.
What is the InChIKey of 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile?
The InChIKey is NTXVYWVBRJBBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O/c1-12-9-13(2)19-15(7-8-23-19)18(12)21(3,26-4)20-24-16-6-5-14(11-22)10-17(16)25-20/h5-10,23H,1-4H3,(H,24,25).
What are the key properties of 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile?
2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile has a molecular weight of 344.42 g/mol, XLogP of 4.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5,7-dimethyl-1H-indol-4-yl)-1-methoxyethyl]-3H-benzimidazole-5-carbonitrile is sourced from PubChem (CID 86701604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).