C21H26N6O5S — CID 86702016
[4-morpholin-4-yl-6-[1-(oxan-2-yl)indazol-4-yl]-1,3,5-triazin-2-yl]methyl methanesulfonate (PubChem CID 86702016) has the molecular formula C21H26N6O5S and a molecular weight of 474.54 g/mol. Its IUPAC name is [4-morpholin-4-yl-6-[1-(oxan-2-yl)indazol-4-yl]-1,3,5-triazin-2-yl]methyl methanesulfonate.
| Compound Name | [4-morpholin-4-yl-6-[1-(oxan-2-yl)indazol-4-yl]-1,3,5-triazin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86702016 |
| Molecular Formula | C21H26N6O5S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [4-morpholin-4-yl-6-[1-(oxan-2-yl)indazol-4-yl]-1,3,5-triazin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1nc(-c2cccc3c2cnn3C2CCCCO2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H26N6O5S/c1-33(28,29)32-14-18-23-20(25-21(24-18)26-8-11-30-12-9-26)15-5-4-6-17-16(15)13-22-27(17)19-7-2-3-10-31-19/h4-6,13,19H,2-3,7-12,14H2,1H3 |
| InChIKey | VNTLOGMZMFFVOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 121.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|