About (3-bromo-5,7-dimethyl-1-adamantyl)methanol
(3-bromo-5,7-dimethyl-1-adamantyl)methanol (PubChem CID 86702092) has the molecular formula C13H21BrO
and a molecular weight of 273.21 g/mol. Its IUPAC name is (3-bromo-5,7-dimethyl-1-adamantyl)methanol.
Molecular Properties
| Compound Name | (3-bromo-5,7-dimethyl-1-adamantyl)methanol |
| PubChem CID | 86702092 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3-bromo-5,7-dimethyl-1-adamantyl)methanol |
| SMILES | CC12CC3(C)CC(Br)(C1)CC(CO)(C2)C3 |
| InChI | InChI=1S/C13H21BrO/c1-10-3-11(2)5-12(4-10,9-15)8-13(14,6-10)7-11/h15H,3-9H2,1-2H3 |
| InChIKey | CNWVDLCYZRZFJH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-5,7-dimethyl-1-adamantyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-5,7-dimethyl-1-adamantyl)methanol?
The IUPAC name of (3-bromo-5,7-dimethyl-1-adamantyl)methanol (CID 86702092) is (3-bromo-5,7-dimethyl-1-adamantyl)methanol.
What is the SMILES notation for (3-bromo-5,7-dimethyl-1-adamantyl)methanol?
The canonical SMILES for (3-bromo-5,7-dimethyl-1-adamantyl)methanol is CC12CC3(C)CC(Br)(C1)CC(CO)(C2)C3.
What is the InChIKey of (3-bromo-5,7-dimethyl-1-adamantyl)methanol?
The InChIKey is CNWVDLCYZRZFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21BrO/c1-10-3-11(2)5-12(4-10,9-15)8-13(14,6-10)7-11/h15H,3-9H2,1-2H3.
What are the key properties of (3-bromo-5,7-dimethyl-1-adamantyl)methanol?
(3-bromo-5,7-dimethyl-1-adamantyl)methanol has a molecular weight of 273.21 g/mol, XLogP of 3.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-5,7-dimethyl-1-adamantyl)methanol is sourced from PubChem (CID 86702092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).