C19H26O5 — CID 86702215
2-methoxy-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone (PubChem CID 86702215) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-methoxy-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone.
| Compound Name | 2-methoxy-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone |
|---|---|
| PubChem CID | 86702215 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-methoxy-1-[2,4,6-trihydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone |
| SMILES | COCC(=O)c1c(O)c(CC=C(C)C)c(O)c(CC=C(C)C)c1O |
| InChI | InChI=1S/C19H26O5/c1-11(2)6-8-13-17(21)14(9-7-12(3)4)19(23)16(18(13)22)15(20)10-24-5/h6-7,21-23H,8-10H2,1-5H3 |
| InChIKey | DOPIILFSGIJDGT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|