C17H9F3O3S — CID 86702312
12-(trifluoromethylsulfonyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 86702312) has the molecular formula C17H9F3O3S and a molecular weight of 350.32 g/mol. Its IUPAC name is 12-(trifluoromethylsulfonyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 12-(trifluoromethylsulfonyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 86702312 |
| Molecular Formula | C17H9F3O3S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 12-(trifluoromethylsulfonyl)-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | O=S(=O)(c1ccc2c3c(cccc13)-c1ccccc1O2)C(F)(F)F |
| InChI | InChI=1S/C17H9F3O3S/c18-17(19,20)24(21,22)15-9-8-14-16-11(5-3-6-12(15)16)10-4-1-2-7-13(10)23-14/h1-9H |
| InChIKey | MMKCIJBXESCLGZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |