About 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid
2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid (PubChem CID 86702803) has the molecular formula C9H11BO5S
and a molecular weight of 242.06 g/mol. Its IUPAC name is 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid.
Molecular Properties
| Compound Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid |
| PubChem CID | 86702803 |
| Molecular Formula | C9H11BO5S |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCc1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C9H11BO5S/c11-10-9-5-7(3-4-16(12,13)14)1-2-8(9)6-15-10/h1-2,5,11H,3-4,6H2,(H,12,13,14) |
| InChIKey | VCACMVFIBUXSRB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid?
The IUPAC name of 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid (CID 86702803) is 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid.
What is the SMILES notation for 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid?
The canonical SMILES for 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid is O=S(=O)(O)CCc1ccc2c(c1)B(O)OC2.
What is the InChIKey of 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid?
The InChIKey is VCACMVFIBUXSRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO5S/c11-10-9-5-7(3-4-16(12,13)14)1-2-8(9)6-15-10/h1-2,5,11H,3-4,6H2,(H,12,13,14).
What are the key properties of 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid?
2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid has a molecular weight of 242.06 g/mol, XLogP of -0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)ethanesulfonic acid is sourced from PubChem (CID 86702803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).