C19H24ClFN2O3S — CID 86702839
4-(1-adamantylmethylamino)-5-chloro-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 86702839) has the molecular formula C19H24ClFN2O3S and a molecular weight of 414.93 g/mol. Its IUPAC name is 4-(1-adamantylmethylamino)-5-chloro-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-(1-adamantylmethylamino)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 86702839 |
| Molecular Formula | C19H24ClFN2O3S |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-(1-adamantylmethylamino)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(NCC23CC4CC(CC(C4)C2)C3)cc1F |
| InChI | InChI=1S/C19H24ClFN2O3S/c1-27(25,26)23-18(24)14-5-15(20)17(6-16(14)21)22-10-19-7-11-2-12(8-19)4-13(3-11)9-19/h5-6,11-13,22H,2-4,7-10H2,1H3,(H,23,24) |
| InChIKey | YNYNRFRTSRAGCR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |