About 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide
5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 86702864) has the molecular formula C18H22F3NO4S
and a molecular weight of 405.44 g/mol. Its IUPAC name is 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide |
| PubChem CID | 86702864 |
| Molecular Formula | C18H22F3NO4S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(C2CC2)c(OCC2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C18H22F3NO4S/c1-27(24,25)22-17(23)14-8-13(12-2-3-12)16(9-15(14)19)26-10-11-4-6-18(20,21)7-5-11/h8-9,11-12H,2-7,10H2,1H3,(H,22,23) |
| InChIKey | TXCVJBLHIKCNRG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide?
The IUPAC name of 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide (CID 86702864) is 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide.
What is the SMILES notation for 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide?
The canonical SMILES for 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide is CS(=O)(=O)NC(=O)c1cc(C2CC2)c(OCC2CCC(F)(F)CC2)cc1F.
What is the InChIKey of 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide?
The InChIKey is TXCVJBLHIKCNRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F3NO4S/c1-27(24,25)22-17(23)14-8-13(12-2-3-12)16(9-15(14)19)26-10-11-4-6-18(20,21)7-5-11/h8-9,11-12H,2-7,10H2,1H3,(H,22,23).
What are the key properties of 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide?
5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide has a molecular weight of 405.44 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-4-[(4,4-difluorocyclohexyl)methoxy]-2-fluoro-N-methylsulfonylbenzamide is sourced from PubChem (CID 86702864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).