C28H24F2N8O5S — CID 86702952
N-[2,4-difluoro-3-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]phenyl]-1-(2-nitrophenyl)methanesulfonamide (PubChem CID 86702952) has the molecular formula C28H24F2N8O5S and a molecular weight of 622.61 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]phenyl]-1-(2-nitrophenyl)methanesulfonamide.
| Compound Name | N-[2,4-difluoro-3-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]phenyl]-1-(2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 86702952 |
| Molecular Formula | C28H24F2N8O5S |
| Molecular Weight | 622.61 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | N-[2,4-difluoro-3-[[3-[9-(oxan-2-yl)purin-6-yl]-2-pyridinyl]amino]phenyl]-1-(2-nitrophenyl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1CS(=O)(=O)Nc1ccc(F)c(Nc2ncccc2-c2ncnc3c2ncn3C2CCCCO2)c1F |
| InChI | InChI=1S/C28H24F2N8O5S/c29-19-10-11-20(36-44(41,42)14-17-6-1-2-8-21(17)38(39)40)23(30)25(19)35-27-18(7-5-12-31-27)24-26-28(33-15-32-24)37(16-34-26)22-9-3-4-13-43-22/h1-2,5-8,10-12,15-16,22,36H,3-4,9,13-14H2,(H,31,35) |
| InChIKey | BLEHEELRNVJBCS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 167.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|