About 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide
2-(3,5-dimethylmorpholin-4-yl)acetohydrazide (PubChem CID 86703014) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide |
| PubChem CID | 86703014 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide |
| SMILES | CC1COCC(C)N1CC(=O)NN |
| InChI | InChI=1S/C8H17N3O2/c1-6-4-13-5-7(2)11(6)3-8(12)10-9/h6-7H,3-5,9H2,1-2H3,(H,10,12) |
| InChIKey | RSXLSDTWVQWEKP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide?
The IUPAC name of 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide (CID 86703014) is 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide.
What is the SMILES notation for 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide?
The canonical SMILES for 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide is CC1COCC(C)N1CC(=O)NN.
What is the InChIKey of 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide?
The InChIKey is RSXLSDTWVQWEKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-6-4-13-5-7(2)11(6)3-8(12)10-9/h6-7H,3-5,9H2,1-2H3,(H,10,12).
What are the key properties of 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide?
2-(3,5-dimethylmorpholin-4-yl)acetohydrazide has a molecular weight of 187.24 g/mol, XLogP of -0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylmorpholin-4-yl)acetohydrazide is sourced from PubChem (CID 86703014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).