About 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide
5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (PubChem CID 86703375) has the molecular formula C21H17N5O2S
and a molecular weight of 403.47 g/mol. Its IUPAC name is 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| PubChem CID | 86703375 |
| Molecular Formula | C21H17N5O2S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C21H17N5O2S/c22-15-8-5-13(6-9-15)19(28)26-20-17(18(23)27)25-21(29-20)24-16-10-7-12-3-1-2-4-14(12)11-16/h1-11H,22H2,(H2,23,27)(H,24,25)(H,26,28) |
| InChIKey | RUMYDPRRAHRPJA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide?
The IUPAC name of 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide (CID 86703375) is 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide is NC(=O)c1nc(Nc2ccc3ccccc3c2)sc1NC(=O)c1ccc(N)cc1.
What is the InChIKey of 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide?
The InChIKey is RUMYDPRRAHRPJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O2S/c22-15-8-5-13(6-9-15)19(28)26-20-17(18(23)27)25-21(29-20)24-16-10-7-12-3-1-2-4-14(12)11-16/h1-11H,22H2,(H2,23,27)(H,24,25)(H,26,28).
What are the key properties of 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide?
5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide has a molecular weight of 403.47 g/mol, XLogP of 3.97, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-aminobenzoyl)amino]-2-(naphthalen-2-ylamino)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 86703375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).