C9H12F3O2- — CID 86703553
1-methyl-4-(trifluoromethyl)cyclohexane-1-carboxylate (PubChem CID 86703553) has the molecular formula C9H12F3O2- and a molecular weight of 209.19 g/mol. Its IUPAC name is 1-methyl-4-(trifluoromethyl)cyclohexane-1-carboxylate.
| Compound Name | 1-methyl-4-(trifluoromethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 86703553 |
| Molecular Formula | C9H12F3O2- |
| Molecular Weight | 209.19 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | 1-methyl-4-(trifluoromethyl)cyclohexane-1-carboxylate |
| SMILES | CC1(C(=O)[O-])CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H13F3O2/c1-8(7(13)14)4-2-6(3-5-8)9(10,11)12/h6H,2-5H2,1H3,(H,13,14)/p-1 |
| InChIKey | YDBKPPHNTABOSV-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |