C25H24ClFN2O4S — CID 86703776
4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-chloro-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 86703776) has the molecular formula C25H24ClFN2O4S and a molecular weight of 503.00 g/mol. Its IUPAC name is 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-chloro-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 86703776 |
| Molecular Formula | C25H24ClFN2O4S |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 4-[(1-benzhydrylazetidin-3-yl)methoxy]-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)c(OCC2CN(C(c3ccccc3)c3ccccc3)C2)cc1F |
| InChI | InChI=1S/C25H24ClFN2O4S/c1-34(31,32)28-25(30)20-12-21(26)23(13-22(20)27)33-16-17-14-29(15-17)24(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-13,17,24H,14-16H2,1H3,(H,28,30) |
| InChIKey | YUDSOPSBYJDZMS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |