About 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide
3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide (PubChem CID 86703899) has the molecular formula C16H14FN5O2
and a molecular weight of 327.32 g/mol. Its IUPAC name is 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide.
Molecular Properties
| Compound Name | 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide |
| PubChem CID | 86703899 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide |
| SMILES | Nc1ncnc2ccc(-c3cc(F)cc(C(=O)NCCO)c3)nc12 |
| InChI | InChI=1S/C16H14FN5O2/c17-11-6-9(5-10(7-11)16(24)19-3-4-23)12-1-2-13-14(22-12)15(18)21-8-20-13/h1-2,5-8,23H,3-4H2,(H,19,24)(H2,18,20,21) |
| InChIKey | CEPKKIZGZIQUDG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide?
The IUPAC name of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide (CID 86703899) is 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide.
What is the SMILES notation for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide?
The canonical SMILES for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide is Nc1ncnc2ccc(-c3cc(F)cc(C(=O)NCCO)c3)nc12.
What is the InChIKey of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide?
The InChIKey is CEPKKIZGZIQUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FN5O2/c17-11-6-9(5-10(7-11)16(24)19-3-4-23)12-1-2-13-14(22-12)15(18)21-8-20-13/h1-2,5-8,23H,3-4H2,(H,19,24)(H2,18,20,21).
What are the key properties of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide?
3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide has a molecular weight of 327.32 g/mol, XLogP of 1.14, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-5-fluoro-N-(2-hydroxyethyl)benzamide is sourced from PubChem (CID 86703899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).