About 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide
3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide (PubChem CID 86703902) has the molecular formula C18H19FN6O
and a molecular weight of 354.39 g/mol. Its IUPAC name is 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide.
Molecular Properties
| Compound Name | 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide |
| PubChem CID | 86703902 |
| Molecular Formula | C18H19FN6O |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide |
| SMILES | CN(C)CCNC(=O)c1cc(F)cc(-c2ccc3ncnc(N)c3n2)c1 |
| InChI | InChI=1S/C18H19FN6O/c1-25(2)6-5-21-18(26)12-7-11(8-13(19)9-12)14-3-4-15-16(24-14)17(20)23-10-22-15/h3-4,7-10H,5-6H2,1-2H3,(H,21,26)(H2,20,22,23) |
| InChIKey | DHSNOXWHQKNDAJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide?
The IUPAC name of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide (CID 86703902) is 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide.
What is the SMILES notation for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide?
The canonical SMILES for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide is CN(C)CCNC(=O)c1cc(F)cc(-c2ccc3ncnc(N)c3n2)c1.
What is the InChIKey of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide?
The InChIKey is DHSNOXWHQKNDAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN6O/c1-25(2)6-5-21-18(26)12-7-11(8-13(19)9-12)14-3-4-15-16(24-14)17(20)23-10-22-15/h3-4,7-10H,5-6H2,1-2H3,(H,21,26)(H2,20,22,23).
What are the key properties of 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide?
3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide has a molecular weight of 354.39 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminopyrido[3,2-d]pyrimidin-6-yl)-N-[2-(dimethylamino)ethyl]-5-fluorobenzamide is sourced from PubChem (CID 86703902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).