C13H9FN4 — CID 86703914
6-(3-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 86703914) has the molecular formula C13H9FN4 and a molecular weight of 240.24 g/mol. Its IUPAC name is 6-(3-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-(3-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 86703914 |
| Molecular Formula | C13H9FN4 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-(3-fluorophenyl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2ccc(-c3cccc(F)c3)nc12 |
| InChI | InChI=1S/C13H9FN4/c14-9-3-1-2-8(6-9)10-4-5-11-12(18-10)13(15)17-7-16-11/h1-7H,(H2,15,16,17) |
| InChIKey | TWTLUQDFSDYZKO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |