C26H12F6N4 — CID 86704332
2,9-bis[4-(trifluoromethyl)phenyl]-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene (PubChem CID 86704332) has the molecular formula C26H12F6N4 and a molecular weight of 494.40 g/mol. Its IUPAC name is 2,9-bis[4-(trifluoromethyl)phenyl]-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene.
| Compound Name | 2,9-bis[4-(trifluoromethyl)phenyl]-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
|---|---|
| PubChem CID | 86704332 |
| Molecular Formula | C26H12F6N4 |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2,9-bis[4-(trifluoromethyl)phenyl]-5,7,12,14-tetrazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),2,4(16),5,7,9,11(15),12-octaene |
| SMILES | FC(F)(F)c1ccc(-c2cc3ncnc4c(-c5ccc(C(F)(F)F)cc5)cc5ncnc2c5c34)cc1 |
| InChI | InChI=1S/C26H12F6N4/c27-25(28,29)15-5-1-13(2-6-15)17-9-19-22-21-20(34-11-35-23(17)21)10-18(24(22)36-12-33-19)14-3-7-16(8-4-14)26(30,31)32/h1-12H |
| InChIKey | FCATUDKTKOSELM-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|