C14H20ClFN4 — CID 86704443
N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine (PubChem CID 86704443) has the molecular formula C14H20ClFN4 and a molecular weight of 298.79 g/mol. Its IUPAC name is N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine.
| Compound Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
|---|---|
| PubChem CID | 86704443 |
| Molecular Formula | C14H20ClFN4 |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-5,5-dimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-amine |
| SMILES | CC1(C)CC(Nc2nc(Cl)ncc2F)CC2CCCN21 |
| InChI | InChI=1S/C14H20ClFN4/c1-14(2)7-9(6-10-4-3-5-20(10)14)18-12-11(16)8-17-13(15)19-12/h8-10H,3-7H2,1-2H3,(H,17,18,19) |
| InChIKey | OAVBCHSOAGIJIQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |