C10H10FN5O — CID 86704468
6-fluoro-4,4-dimethyltetrazolo[5,1-c][1,4]benzoxazin-8-amine (PubChem CID 86704468) has the molecular formula C10H10FN5O and a molecular weight of 235.22 g/mol. Its IUPAC name is 6-fluoro-4,4-dimethyltetrazolo[5,1-c][1,4]benzoxazin-8-amine.
| Compound Name | 6-fluoro-4,4-dimethyltetrazolo[5,1-c][1,4]benzoxazin-8-amine |
|---|---|
| PubChem CID | 86704468 |
| Molecular Formula | C10H10FN5O |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 6-fluoro-4,4-dimethyltetrazolo[5,1-c][1,4]benzoxazin-8-amine |
| SMILES | CC1(C)Oc2c(F)cc(N)cc2-n2nnnc21 |
| InChI | InChI=1S/C10H10FN5O/c1-10(2)9-13-14-15-16(9)7-4-5(12)3-6(11)8(7)17-10/h3-4H,12H2,1-2H3 |
| InChIKey | ULMRQZPJXGQSIT-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|