About 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane]
9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] (PubChem CID 86704523) has the molecular formula C10H7N5O4
and a molecular weight of 261.20 g/mol. Its IUPAC name is 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane].
Molecular Properties
| Compound Name | 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] |
| PubChem CID | 86704523 |
| Molecular Formula | C10H7N5O4 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)-n1nnnc1C1(CO2)CO1 |
| InChI | InChI=1S/C10H7N5O4/c16-15(17)6-1-2-8-7(3-6)14-9(11-12-13-14)10(4-18-8)5-19-10/h1-3H,4-5H2 |
| InChIKey | IYWDRGWTSNCAOL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane]?
The IUPAC name of 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] (CID 86704523) is 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane].
What is the SMILES notation for 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane]?
The canonical SMILES for 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] is O=[N+]([O-])c1ccc2c(c1)-n1nnnc1C1(CO2)CO1.
What is the InChIKey of 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane]?
The InChIKey is IYWDRGWTSNCAOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O4/c16-15(17)6-1-2-8-7(3-6)14-9(11-12-13-14)10(4-18-8)5-19-10/h1-3H,4-5H2.
What are the key properties of 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane]?
9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] has a molecular weight of 261.20 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-nitrospiro[5H-tetrazolo[5,1-d][1,5]benzoxazepine-4,2'-oxirane] is sourced from PubChem (CID 86704523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).