C23H20BrN3O2 — CID 86704901
methyl 6-[[6-(2-bromoethyl)-2-phenylpyrazolo[1,5-a]pyridin-3-yl]methyl]pyridine-2-carboxylate (PubChem CID 86704901) has the molecular formula C23H20BrN3O2 and a molecular weight of 450.34 g/mol. Its IUPAC name is methyl 6-[[6-(2-bromoethyl)-2-phenylpyrazolo[1,5-a]pyridin-3-yl]methyl]pyridine-2-carboxylate.
| Compound Name | methyl 6-[[6-(2-bromoethyl)-2-phenylpyrazolo[1,5-a]pyridin-3-yl]methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 86704901 |
| Molecular Formula | C23H20BrN3O2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | methyl 6-[[6-(2-bromoethyl)-2-phenylpyrazolo[1,5-a]pyridin-3-yl]methyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Cc2c(-c3ccccc3)nn3cc(CCBr)ccc23)n1 |
| InChI | InChI=1S/C23H20BrN3O2/c1-29-23(28)20-9-5-8-18(25-20)14-19-21-11-10-16(12-13-24)15-27(21)26-22(19)17-6-3-2-4-7-17/h2-11,15H,12-14H2,1H3 |
| InChIKey | NYIPROLXNHMUEL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|