About 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol
4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol (PubChem CID 86705006) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol.
Molecular Properties
| Compound Name | 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol |
| PubChem CID | 86705006 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol |
| SMILES | CCCCC[C@H]1C[C@@H]1CC#CCO |
| InChI | InChI=1S/C12H20O/c1-2-3-4-7-11-10-12(11)8-5-6-9-13/h11-13H,2-4,7-10H2,1H3/t11-,12-/m0/s1 |
| InChIKey | RADNHTYENFBJSL-RYUDHWBXSA-N |
| XLogP | 2.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol?
The IUPAC name of 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol (CID 86705006) is 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol.
What is the SMILES notation for 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol?
The canonical SMILES for 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol is CCCCC[C@H]1C[C@@H]1CC#CCO.
What is the InChIKey of 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol?
The InChIKey is RADNHTYENFBJSL-RYUDHWBXSA-N. The full InChI is InChI=1S/C12H20O/c1-2-3-4-7-11-10-12(11)8-5-6-9-13/h11-13H,2-4,7-10H2,1H3/t11-,12-/m0/s1.
What are the key properties of 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol?
4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol has a molecular weight of 180.29 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1R,2S)-2-pentylcyclopropyl]but-2-yn-1-ol is sourced from PubChem (CID 86705006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).