C27H36ClF3N2O3SSi — CID 86705064
N-[1-[3-(4-chlorophenyl)-6,6,6-trifluorohexan-3-yl]indol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide (PubChem CID 86705064) has the molecular formula C27H36ClF3N2O3SSi and a molecular weight of 589.20 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)-6,6,6-trifluorohexan-3-yl]indol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)-6,6,6-trifluorohexan-3-yl]indol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
|---|---|
| PubChem CID | 86705064 |
| Molecular Formula | C27H36ClF3N2O3SSi |
| Molecular Weight | 589.20 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)-6,6,6-trifluorohexan-3-yl]indol-4-yl]-N-(2-trimethylsilylethoxymethyl)methanesulfonamide |
| SMILES | CCC(CCC(F)(F)F)(c1ccc(Cl)cc1)n1ccc2c(N(COCC[Si](C)(C)C)S(C)(=O)=O)cccc21 |
| InChI | InChI=1S/C27H36ClF3N2O3SSi/c1-6-26(15-16-27(29,30)31,21-10-12-22(28)13-11-21)32-17-14-23-24(32)8-7-9-25(23)33(37(2,34)35)20-36-18-19-38(3,4)5/h7-14,17H,6,15-16,18-20H2,1-5H3 |
| InChIKey | HWVQJGNGTHISIZ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.20 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|