C22H21F3N4OS — CID 86705207
2-amino-5-piperidin-1-yl-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 86705207) has the molecular formula C22H21F3N4OS and a molecular weight of 446.50 g/mol. Its IUPAC name is 2-amino-5-piperidin-1-yl-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-amino-5-piperidin-1-yl-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 86705207 |
| Molecular Formula | C22H21F3N4OS |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-amino-5-piperidin-1-yl-N-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | Nc1ccc(N2CCCCC2)cc1C(=O)Nc1nc(-c2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C22H21F3N4OS/c23-22(24,25)15-6-4-5-14(11-15)19-13-31-21(27-19)28-20(30)17-12-16(7-8-18(17)26)29-9-2-1-3-10-29/h4-8,11-13H,1-3,9-10,26H2,(H,27,28,30) |
| InChIKey | PDNANDNPHVLOFO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|