C24H20F2N4O5S — CID 86705619
5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 86705619) has the molecular formula C24H20F2N4O5S and a molecular weight of 514.51 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 86705619 |
| Molecular Formula | C24H20F2N4O5S |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | 5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(ccn4S(=O)(=O)c4ccccc4)c3N(C)C2=O)c1F |
| InChI | InChI=1S/C24H20F2N4O5S/c1-28-21-14(13-29(24(28)31)22-19(25)17(34-2)11-18(35-3)20(22)26)12-27-23-16(21)9-10-30(23)36(32,33)15-7-5-4-6-8-15/h4-12H,13H2,1-3H3 |
| InChIKey | VPQRTEUATZVOQD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |