C23H22F2N4O4 — CID 86705622
11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-(3,6-dihydro-2H-pyran-4-yl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 86705622) has the molecular formula C23H22F2N4O4 and a molecular weight of 456.45 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-(3,6-dihydro-2H-pyran-4-yl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-(3,6-dihydro-2H-pyran-4-yl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 86705622 |
| Molecular Formula | C23H22F2N4O4 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-(3,6-dihydro-2H-pyran-4-yl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(C5=CCOCC5)cc4c3N(C)C2=O)c1F |
| InChI | InChI=1S/C23H22F2N4O4/c1-28-20-13(10-26-22-14(20)8-15(27-22)12-4-6-33-7-5-12)11-29(23(28)30)21-18(24)16(31-2)9-17(32-3)19(21)25/h4,8-10H,5-7,11H2,1-3H3,(H,26,27) |
| InChIKey | RMWYLZNERQHZHL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |