C17H15F2N5O3 — CID 86705637
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 86705637) has the molecular formula C17H15F2N5O3 and a molecular weight of 375.34 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 86705637 |
| Molecular Formula | C17H15F2N5O3 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4,5,7,11,13-pentazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]ncc4c3N(C)C2=O)c1F |
| InChI | InChI=1S/C17H15F2N5O3/c1-23-14-8(5-20-16-9(14)6-21-22-16)7-24(17(23)25)15-12(18)10(26-2)4-11(27-3)13(15)19/h4-6H,7H2,1-3H3,(H,20,21,22) |
| InChIKey | NAXMPDJKRUSHCA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |