C26H22F2N4O6S — CID 86705663
2-[5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-4-yl]acetaldehyde (PubChem CID 86705663) has the molecular formula C26H22F2N4O6S and a molecular weight of 556.55 g/mol. Its IUPAC name is 2-[5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-4-yl]acetaldehyde.
| Compound Name | 2-[5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 86705663 |
| Molecular Formula | C26H22F2N4O6S |
| Molecular Weight | 556.55 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-[5-(benzenesulfonyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-4-yl]acetaldehyde |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(cc(CC=O)n4S(=O)(=O)c4ccccc4)c3N(C)C2=O)c1F |
| InChI | InChI=1S/C26H22F2N4O6S/c1-30-23-15(14-31(26(30)34)24-21(27)19(37-2)12-20(38-3)22(24)28)13-29-25-18(23)11-16(9-10-33)32(25)39(35,36)17-7-5-4-6-8-17/h4-8,10-13H,9,14H2,1-3H3 |
| InChIKey | SSJFTZNTYUTXBL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|