C24H27F2N5O3 — CID 86705668
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4-(piperidin-4-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 86705668) has the molecular formula C24H27F2N5O3 and a molecular weight of 471.51 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4-(piperidin-4-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4-(piperidin-4-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 86705668 |
| Molecular Formula | C24H27F2N5O3 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-methyl-4-(piperidin-4-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(CC5CCNCC5)cc4c3N(C)C2=O)c1F |
| InChI | InChI=1S/C24H27F2N5O3/c1-30-21-14(11-28-23-16(21)9-15(29-23)8-13-4-6-27-7-5-13)12-31(24(30)32)22-19(25)17(33-2)10-18(34-3)20(22)26/h9-11,13,27H,4-8,12H2,1-3H3,(H,28,29) |
| InChIKey | AIUYTJQKXJIIMJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |