About methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate
methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate (PubChem CID 86706054) has the molecular formula C8H12F3NO2
and a molecular weight of 211.18 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate.
Molecular Properties
| Compound Name | methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate |
| PubChem CID | 86706054 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate |
| SMILES | COC(=O)[C@@H](/N=C/C(F)(F)F)C(C)C |
| InChI | InChI=1S/C8H12F3NO2/c1-5(2)6(7(13)14-3)12-4-8(9,10)11/h4-6H,1-3H3/b12-4+/t6-/m0/s1 |
| InChIKey | DBSTVOYFFBWIAF-JSTDCQMXSA-N |
| XLogP | 1.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate?
The IUPAC name of methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate (CID 86706054) is methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate.
What is the SMILES notation for methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate?
The canonical SMILES for methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate is COC(=O)[C@@H](/N=C/C(F)(F)F)C(C)C.
What is the InChIKey of methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate?
The InChIKey is DBSTVOYFFBWIAF-JSTDCQMXSA-N. The full InChI is InChI=1S/C8H12F3NO2/c1-5(2)6(7(13)14-3)12-4-8(9,10)11/h4-6H,1-3H3/b12-4+/t6-/m0/s1.
What are the key properties of methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate?
methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate has a molecular weight of 211.18 g/mol, XLogP of 1.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate is sourced from PubChem (CID 86706054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).