About benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate
benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate (PubChem CID 86706169) has the molecular formula C17H21F3O7S
and a molecular weight of 426.41 g/mol. Its IUPAC name is benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate |
| PubChem CID | 86706169 |
| Molecular Formula | C17H21F3O7S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate |
| SMILES | CC(OS(=O)(=O)C(F)(F)F)C1(C(=O)OCc2ccccc2)COC(C)(C)CO1 |
| InChI | InChI=1S/C17H21F3O7S/c1-12(27-28(22,23)17(18,19)20)16(11-25-15(2,3)10-26-16)14(21)24-9-13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | ITALJUQWIXCAFD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate?
The IUPAC name of benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate (CID 86706169) is benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate.
What is the SMILES notation for benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate?
The canonical SMILES for benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate is CC(OS(=O)(=O)C(F)(F)F)C1(C(=O)OCc2ccccc2)COC(C)(C)CO1.
What is the InChIKey of benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate?
The InChIKey is ITALJUQWIXCAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3O7S/c1-12(27-28(22,23)17(18,19)20)16(11-25-15(2,3)10-26-16)14(21)24-9-13-7-5-4-6-8-13/h4-8,12H,9-11H2,1-3H3.
What are the key properties of benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate?
benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate has a molecular weight of 426.41 g/mol, XLogP of 2.55, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5,5-dimethyl-2-[1-(trifluoromethylsulfonyloxy)ethyl]-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 86706169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).