About tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate
tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate (PubChem CID 86706641) has the molecular formula C17H22ClFN4O2
and a molecular weight of 368.84 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate |
| PubChem CID | 86706641 |
| Molecular Formula | C17H22ClFN4O2 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](Nc2nc(Cl)c(C#N)cc2F)C1 |
| InChI | InChI=1S/C17H22ClFN4O2/c1-17(2,3)25-16(24)22-12-6-4-5-11(8-12)21-15-13(19)7-10(9-20)14(18)23-15/h7,11-12H,4-6,8H2,1-3H3,(H,21,23)(H,22,24)/t11-,12+/m0/s1 |
| InChIKey | DHUCQTATLHWWKC-NWDGAFQWSA-N |
| XLogP | 3.99 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate?
The IUPAC name of tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate (CID 86706641) is tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate.
What is the SMILES notation for tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate?
The canonical SMILES for tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate is CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](Nc2nc(Cl)c(C#N)cc2F)C1.
What is the InChIKey of tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate?
The InChIKey is DHUCQTATLHWWKC-NWDGAFQWSA-N. The full InChI is InChI=1S/C17H22ClFN4O2/c1-17(2,3)25-16(24)22-12-6-4-5-11(8-12)21-15-13(19)7-10(9-20)14(18)23-15/h7,11-12H,4-6,8H2,1-3H3,(H,21,23)(H,22,24)/t11-,12+/m0/s1.
What are the key properties of tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate?
tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate has a molecular weight of 368.84 g/mol, XLogP of 3.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(1R,3S)-3-[(6-chloro-5-cyano-3-fluoro-2-pyridinyl)amino]cyclohexyl]carbamate is sourced from PubChem (CID 86706641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).