C16H9Cl3F3NO3 — CID 86706653
2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carbaldehyde (PubChem CID 86706653) has the molecular formula C16H9Cl3F3NO3 and a molecular weight of 426.61 g/mol. Its IUPAC name is 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carbaldehyde.
| Compound Name | 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carbaldehyde |
|---|---|
| PubChem CID | 86706653 |
| Molecular Formula | C16H9Cl3F3NO3 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | 2-methyl-5-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]furan-3-carbaldehyde |
| SMILES | Cc1oc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1C=O |
| InChI | InChI=1S/C16H9Cl3F3NO3/c1-7-8(6-24)2-13(25-7)12-5-15(26-23-12,16(20,21)22)9-3-10(17)14(19)11(18)4-9/h2-4,6H,5H2,1H3 |
| InChIKey | RUEKFMOVHFECGL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|