About 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione
6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione (PubChem CID 86706693) has the molecular formula C14H12BrFO2
and a molecular weight of 311.15 g/mol. Its IUPAC name is 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione.
Molecular Properties
| Compound Name | 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione |
| PubChem CID | 86706693 |
| Molecular Formula | C14H12BrFO2 |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione |
| SMILES | O=C1CCC2(CC1)Cc1cc(F)c(Br)cc1C2=O |
| InChI | InChI=1S/C14H12BrFO2/c15-11-6-10-8(5-12(11)16)7-14(13(10)18)3-1-9(17)2-4-14/h5-6H,1-4,7H2 |
| InChIKey | YVGVGDOOGHGJFC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione?
The IUPAC name of 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione (CID 86706693) is 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione.
What is the SMILES notation for 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione?
The canonical SMILES for 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione is O=C1CCC2(CC1)Cc1cc(F)c(Br)cc1C2=O.
What is the InChIKey of 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione?
The InChIKey is YVGVGDOOGHGJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrFO2/c15-11-6-10-8(5-12(11)16)7-14(13(10)18)3-1-9(17)2-4-14/h5-6H,1-4,7H2.
What are the key properties of 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione?
6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione has a molecular weight of 311.15 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-fluorospiro[3H-indene-2,4'-cyclohexane]-1,1'-dione is sourced from PubChem (CID 86706693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).