About 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one
6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one (PubChem CID 86706694) has the molecular formula C14H14BrFO2
and a molecular weight of 313.17 g/mol. Its IUPAC name is 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| PubChem CID | 86706694 |
| Molecular Formula | C14H14BrFO2 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one |
| SMILES | O=C1c2cc(Br)c(F)cc2CC12CCC(O)CC2 |
| InChI | InChI=1S/C14H14BrFO2/c15-11-6-10-8(5-12(11)16)7-14(13(10)18)3-1-9(17)2-4-14/h5-6,9,17H,1-4,7H2 |
| InChIKey | XERXWQZPURTIEV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The IUPAC name of 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one (CID 86706694) is 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one.
What is the SMILES notation for 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The canonical SMILES for 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one is O=C1c2cc(Br)c(F)cc2CC12CCC(O)CC2.
What is the InChIKey of 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
The InChIKey is XERXWQZPURTIEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrFO2/c15-11-6-10-8(5-12(11)16)7-14(13(10)18)3-1-9(17)2-4-14/h5-6,9,17H,1-4,7H2.
What are the key properties of 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one?
6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one has a molecular weight of 313.17 g/mol, XLogP of 3.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-fluoro-4'-hydroxyspiro[3H-indene-2,1'-cyclohexane]-1-one is sourced from PubChem (CID 86706694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).