C12H32N4 — CID 86706702
N,N,N',N'-tetramethylethane-1,2-diamine (PubChem CID 86706702) has the molecular formula C12H32N4 and a molecular weight of 232.42 g/mol. Its IUPAC name is N,N,N',N'-tetramethylethane-1,2-diamine.
| Compound Name | N,N,N',N'-tetramethylethane-1,2-diamine |
|---|---|
| PubChem CID | 86706702 |
| Molecular Formula | C12H32N4 |
| Molecular Weight | 232.42 g/mol |
| Exact Mass | 232.26 |
| IUPAC Name | N,N,N',N'-tetramethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C.CN(C)CCN(C)C |
| InChI | InChI=1S/2C6H16N2/c2*1-7(2)5-6-8(3)4/h2*5-6H2,1-4H3 |
| InChIKey | FGNGTWFJQFTFGN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.42 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |