About (2R,6S)-2,6-dimethyloxane-4-thiol
(2R,6S)-2,6-dimethyloxane-4-thiol (PubChem CID 86706716) has the molecular formula C7H14OS
and a molecular weight of 146.25 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyloxane-4-thiol.
Molecular Properties
| Compound Name | (2R,6S)-2,6-dimethyloxane-4-thiol |
| PubChem CID | 86706716 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (2R,6S)-2,6-dimethyloxane-4-thiol |
| SMILES | C[C@@H]1CC(S)C[C@H](C)O1 |
| InChI | InChI=1S/C7H14OS/c1-5-3-7(9)4-6(2)8-5/h5-7,9H,3-4H2,1-2H3/t5-,6+,7? |
| InChIKey | FQXLSQQZCJKEQV-MEKDEQNOSA-N |
| XLogP | 1.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-2,6-dimethyloxane-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,6-dimethyloxane-4-thiol?
The IUPAC name of (2R,6S)-2,6-dimethyloxane-4-thiol (CID 86706716) is (2R,6S)-2,6-dimethyloxane-4-thiol.
What is the SMILES notation for (2R,6S)-2,6-dimethyloxane-4-thiol?
The canonical SMILES for (2R,6S)-2,6-dimethyloxane-4-thiol is C[C@@H]1CC(S)C[C@H](C)O1.
What is the InChIKey of (2R,6S)-2,6-dimethyloxane-4-thiol?
The InChIKey is FQXLSQQZCJKEQV-MEKDEQNOSA-N. The full InChI is InChI=1S/C7H14OS/c1-5-3-7(9)4-6(2)8-5/h5-7,9H,3-4H2,1-2H3/t5-,6+,7?.
What are the key properties of (2R,6S)-2,6-dimethyloxane-4-thiol?
(2R,6S)-2,6-dimethyloxane-4-thiol has a molecular weight of 146.25 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,6-dimethyloxane-4-thiol is sourced from PubChem (CID 86706716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).