C25H33BN4O4S — CID 86706935
7-(4-methylphenyl)sulfonyl-4-(3-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 86706935) has the molecular formula C25H33BN4O4S and a molecular weight of 496.44 g/mol. Its IUPAC name is 7-(4-methylphenyl)sulfonyl-4-(3-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-(4-methylphenyl)sulfonyl-4-(3-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 86706935 |
| Molecular Formula | C25H33BN4O4S |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 7-(4-methylphenyl)sulfonyl-4-(3-methylpiperidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(B3OC(C)(C)C(C)(C)O3)c3c(N4CCCC(C)C4)ncnc32)cc1 |
| InChI | InChI=1S/C25H33BN4O4S/c1-17-9-11-19(12-10-17)35(31,32)30-15-20(26-33-24(3,4)25(5,6)34-26)21-22(27-16-28-23(21)30)29-13-7-8-18(2)14-29/h9-12,15-16,18H,7-8,13-14H2,1-6H3 |
| InChIKey | CFOSURHAGGGJBD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|