C18H22ClF2N5O2 — CID 86706994
tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-4,4-difluoropiperidine-1-carboxylate (PubChem CID 86706994) has the molecular formula C18H22ClF2N5O2 and a molecular weight of 413.86 g/mol. Its IUPAC name is tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-4,4-difluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-4,4-difluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86706994 |
| Molecular Formula | C18H22ClF2N5O2 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | tert-butyl 3-[[(7-chloropyrido[3,4-b]pyrazin-5-yl)amino]methyl]-4,4-difluoropiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(F)C(CNc2nc(Cl)cc3nccnc23)C1 |
| InChI | InChI=1S/C18H22ClF2N5O2/c1-17(2,3)28-16(27)26-7-4-18(20,21)11(10-26)9-24-15-14-12(8-13(19)25-15)22-5-6-23-14/h5-6,8,11H,4,7,9-10H2,1-3H3,(H,24,25) |
| InChIKey | AUWDSPZUXNZBAB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|