C17H22F3N5OSi — CID 86707163
trimethyl-[2-[[6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl]silane (PubChem CID 86707163) has the molecular formula C17H22F3N5OSi and a molecular weight of 397.48 g/mol. Its IUPAC name is trimethyl-[2-[[6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 86707163 |
| Molecular Formula | C17H22F3N5OSi |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | trimethyl-[2-[[6-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrazolo[4,3-c]pyridin-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ncc2cnc(-c3cnn(CC(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C17H22F3N5OSi/c1-27(2,3)5-4-26-12-25-16-6-15(21-7-13(16)8-23-25)14-9-22-24(10-14)11-17(18,19)20/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | MKWKJLPBVPYDLO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|