About [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate
[(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate (PubChem CID 86707400) has the molecular formula C8H4ClF6NO3S
and a molecular weight of 343.63 g/mol. Its IUPAC name is [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
| PubChem CID | 86707400 |
| Molecular Formula | C8H4ClF6NO3S |
| Molecular Weight | 343.63 g/mol |
| Exact Mass | 342.95 |
| IUPAC Name | [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@H](c1ccc(Cl)nc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF6NO3S/c9-5-2-1-4(3-16-5)6(7(10,11)12)19-20(17,18)8(13,14)15/h1-3,6H/t6-/m1/s1 |
| InChIKey | NQHBUZRTLSGSPG-ZCFIWIBFSA-N |
| XLogP | 3.20 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate?
The IUPAC name of [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate (CID 86707400) is [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate.
What is the SMILES notation for [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate?
The canonical SMILES for [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate is O=S(=O)(O[C@H](c1ccc(Cl)nc1)C(F)(F)F)C(F)(F)F.
What is the InChIKey of [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate?
The InChIKey is NQHBUZRTLSGSPG-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H4ClF6NO3S/c9-5-2-1-4(3-16-5)6(7(10,11)12)19-20(17,18)8(13,14)15/h1-3,6H/t6-/m1/s1.
What are the key properties of [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate?
[(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate has a molecular weight of 343.63 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(6-chloro-3-pyridinyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate is sourced from PubChem (CID 86707400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).