C27H29F3N6O3 — CID 86707410
tert-butyl N-[(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-(8-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-yl]carbamate (PubChem CID 86707410) has the molecular formula C27H29F3N6O3 and a molecular weight of 542.56 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-(8-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-(8-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86707410 |
| Molecular Formula | C27H29F3N6O3 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | tert-butyl N-[(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-(8-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-yl]carbamate |
| SMILES | COc1cccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](NC(=O)OC(C)(C)C)C5)C(F)(F)F)cn34)nc12 |
| InChI | InChI=1S/C27H29F3N6O3/c1-26(2,3)39-25(37)31-18-12-13-35(15-18)23(27(28,29)30)17-9-11-21-33-34-24(36(21)14-17)19-10-8-16-6-5-7-20(38-4)22(16)32-19/h5-11,14,18,23H,12-13,15H2,1-4H3,(H,31,37)/t18-,23+/m0/s1 |
| InChIKey | DHRYTVOGXFGKFJ-FDDCHVKYSA-N |
| XLogP | 5.16 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |