C24H33N7O4S2 — CID 86707723
tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl]carbamate (PubChem CID 86707723) has the molecular formula C24H33N7O4S2 and a molecular weight of 547.71 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 86707723 |
| Molecular Formula | C24H33N7O4S2 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | tert-butyl N-[(1S,3R)-3-[[3-carbamoyl-6-(5-methylsulfinyl-1,3,4-thiadiazol-2-yl)pyrrolo[1,2-b]pyridazin-4-yl]amino]-1,2,2-trimethylcyclopentyl]carbamate |
| SMILES | CS(=O)c1nnc(-c2cc3c(N[C@@H]4CC[C@](C)(NC(=O)OC(C)(C)C)C4(C)C)c(C(N)=O)cnn3c2)s1 |
| InChI | InChI=1S/C24H33N7O4S2/c1-22(2,3)35-20(33)28-24(6)9-8-16(23(24,4)5)27-17-14(18(25)32)11-26-31-12-13(10-15(17)31)19-29-30-21(36-19)37(7)34/h10-12,16,27H,8-9H2,1-7H3,(H2,25,32)(H,28,33)/t16-,24+,37?/m1/s1 |
| InChIKey | QQUJIQCHTMLDGI-PCZOHBSFSA-N |
| XLogP | 3.57 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |