C12H17F3N2O4 — CID 86707726
tert-butyl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate (PubChem CID 86707726) has the molecular formula C12H17F3N2O4 and a molecular weight of 310.27 g/mol. Its IUPAC name is tert-butyl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 86707726 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | tert-butyl 2-[4-methyl-2,5-dioxo-1-(2,2,2-trifluoroethyl)imidazolidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(C)NC(=O)N(CC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H17F3N2O4/c1-10(2,3)21-7(18)5-11(4)8(19)17(9(20)16-11)6-12(13,14)15/h5-6H2,1-4H3,(H,16,20) |
| InChIKey | JVTRJPWVZHJZKG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|