C20H14Cl3F3N2O3 — CID 86707796
1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylic acid (PubChem CID 86707796) has the molecular formula C20H14Cl3F3N2O3 and a molecular weight of 493.70 g/mol. Its IUPAC name is 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 86707796 |
| Molecular Formula | C20H14Cl3F3N2O3 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 492.00 |
| IUPAC Name | 1-[4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc(C3=NOC(c4cc(Cl)c(Cl)c(Cl)c4)(C(F)(F)F)C3)cc2)C1 |
| InChI | InChI=1S/C20H14Cl3F3N2O3/c21-14-5-12(6-15(22)17(14)23)19(20(24,25)26)7-16(27-31-19)10-1-3-13(4-2-10)28-8-11(9-28)18(29)30/h1-6,11H,7-9H2,(H,29,30) |
| InChIKey | FVLIJLLMCSIPDX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|