About [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane
[(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 86709003) has the molecular formula C22H29N3O2Si
and a molecular weight of 395.58 g/mol. Its IUPAC name is [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane.
Molecular Properties
| Compound Name | [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| PubChem CID | 86709003 |
| Molecular Formula | C22H29N3O2Si |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@H]1OCCC[C@@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O2Si/c1-22(2,3)28(18-11-6-4-7-12-18,19-13-8-5-9-14-19)27-17-21-20(24-25-23)15-10-16-26-21/h4-9,11-14,20-21H,10,15-17H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | XZBFGGDTPVNHJA-LEWJYISDSA-N |
| XLogP | 4.42 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane?
The IUPAC name of [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane (CID 86709003) is [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane.
What is the SMILES notation for [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane?
The canonical SMILES for [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane is CC(C)(C)[Si](OC[C@H]1OCCC[C@@H]1N=[N+]=[N-])(c1ccccc1)c1ccccc1.
What is the InChIKey of [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane?
The InChIKey is XZBFGGDTPVNHJA-LEWJYISDSA-N. The full InChI is InChI=1S/C22H29N3O2Si/c1-22(2,3)28(18-11-6-4-7-12-18,19-13-8-5-9-14-19)27-17-21-20(24-25-23)15-10-16-26-21/h4-9,11-14,20-21H,10,15-17H2,1-3H3/t20-,21+/m0/s1.
What are the key properties of [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane?
[(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane has a molecular weight of 395.58 g/mol, XLogP of 4.42, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-azidooxan-2-yl]methoxy-tert-butyl-diphenylsilane is sourced from PubChem (CID 86709003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).